C13H17NO2S — CID 174876491
4-phenylhepta-1,6-diene-4-sulfonamide (PubChem CID 174876491) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-phenylhepta-1,6-diene-4-sulfonamide.
| Compound Name | 4-phenylhepta-1,6-diene-4-sulfonamide |
|---|---|
| PubChem CID | 174876491 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-phenylhepta-1,6-diene-4-sulfonamide |
| SMILES | C=CCC(CC=C)(c1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C13H17NO2S/c1-3-10-13(11-4-2,17(14,15)16)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2,(H2,14,15,16) |
| InChIKey | KKXUFTQLDWPRNT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|