C17H15N — CID 10681154
2,2-diphenylpent-4-enenitrile (PubChem CID 10681154) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 2,2-diphenylpent-4-enenitrile.
| Compound Name | 2,2-diphenylpent-4-enenitrile |
|---|---|
| PubChem CID | 10681154 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2,2-diphenylpent-4-enenitrile |
| SMILES | C=CCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H15N/c1-2-13-17(14-18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h2-12H,1,13H2 |
| InChIKey | FGMBSKDBJUARKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|