About 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile
3-(4-chlorophenyl)-2,2-diphenylpropanenitrile (PubChem CID 2442406) has the molecular formula C21H16ClN
and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile |
| PubChem CID | 2442406 |
| Molecular Formula | C21H16ClN |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile |
| SMILES | N#CC(Cc1ccc(Cl)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClN/c22-20-13-11-17(12-14-20)15-21(16-23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15H2 |
| InChIKey | VMQOAYUAXDFVDB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile?
The IUPAC name of 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile (CID 2442406) is 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile.
What is the SMILES notation for 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile?
The canonical SMILES for 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile is N#CC(Cc1ccc(Cl)cc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile?
The InChIKey is VMQOAYUAXDFVDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClN/c22-20-13-11-17(12-14-20)15-21(16-23,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-14H,15H2.
What are the key properties of 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile?
3-(4-chlorophenyl)-2,2-diphenylpropanenitrile has a molecular weight of 317.82 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2,2-diphenylpropanenitrile is sourced from PubChem (CID 2442406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).