C14H11ClF2 — CID 12634147
1-chloro-4-(1,1-difluoro-2-phenylethyl)benzene (PubChem CID 12634147) has the molecular formula C14H11ClF2 and a molecular weight of 252.69 g/mol. Its IUPAC name is 1-chloro-4-(1,1-difluoro-2-phenylethyl)benzene.
| Compound Name | 1-chloro-4-(1,1-difluoro-2-phenylethyl)benzene |
|---|---|
| PubChem CID | 12634147 |
| Molecular Formula | C14H11ClF2 |
| Molecular Weight | 252.69 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-chloro-4-(1,1-difluoro-2-phenylethyl)benzene |
| SMILES | FC(F)(Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClF2/c15-13-8-6-12(7-9-13)14(16,17)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | TUOOELYTLAVDHX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |