C22H16ClF3O3 — CID 163810081
2-(4-chlorophenyl)-3-phenyl-2-[3-(trifluoromethyl)phenoxy]propanoic acid (PubChem CID 163810081) has the molecular formula C22H16ClF3O3 and a molecular weight of 420.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-phenyl-2-[3-(trifluoromethyl)phenoxy]propanoic acid.
| Compound Name | 2-(4-chlorophenyl)-3-phenyl-2-[3-(trifluoromethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 163810081 |
| Molecular Formula | C22H16ClF3O3 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 2-(4-chlorophenyl)-3-phenyl-2-[3-(trifluoromethyl)phenoxy]propanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)(Oc1cccc(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClF3O3/c23-18-11-9-16(10-12-18)21(20(27)28,14-15-5-2-1-3-6-15)29-19-8-4-7-17(13-19)22(24,25)26/h1-13H,14H2,(H,27,28) |
| InChIKey | NMLVYVIJMRQRJR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |