C16H12ClF3O3 — CID 100541246
(2R)-2-(4-chlorophenoxy)-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 100541246) has the molecular formula C16H12ClF3O3 and a molecular weight of 344.72 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2R)-2-(4-chlorophenoxy)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 100541246 |
| Molecular Formula | C16H12ClF3O3 |
| Molecular Weight | 344.72 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1cccc(C(F)(F)F)c1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClF3O3/c17-12-4-6-13(7-5-12)23-14(15(21)22)9-10-2-1-3-11(8-10)16(18,19)20/h1-8,14H,9H2,(H,21,22)/t14-/m1/s1 |
| InChIKey | HYGJBHARMHZTGI-CQSZACIVSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |