C20H15F3O3 — CID 133245707
2-naphthalen-1-yloxy-3-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 133245707) has the molecular formula C20H15F3O3 and a molecular weight of 360.33 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-3-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-naphthalen-1-yloxy-3-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 133245707 |
| Molecular Formula | C20H15F3O3 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 2-naphthalen-1-yloxy-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(C(F)(F)F)c1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C20H15F3O3/c21-20(22,23)15-8-3-5-13(11-15)12-18(19(24)25)26-17-10-4-7-14-6-1-2-9-16(14)17/h1-11,18H,12H2,(H,24,25) |
| InChIKey | SCJLHJIYANUJGD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |