About chlorobenzene;trifluoromethylbenzene
chlorobenzene;trifluoromethylbenzene (PubChem CID 159341337) has the molecular formula C13H10ClF3
and a molecular weight of 258.67 g/mol. Its IUPAC name is chlorobenzene;trifluoromethylbenzene.
Molecular Properties
| Compound Name | chlorobenzene;trifluoromethylbenzene |
| PubChem CID | 159341337 |
| Molecular Formula | C13H10ClF3 |
| Molecular Weight | 258.67 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | chlorobenzene;trifluoromethylbenzene |
| SMILES | Clc1ccccc1.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C7H5F3.C6H5Cl/c8-7(9,10)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H;1-5H |
| InChIKey | LGEGXTGRNMTIMS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chlorobenzene;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;trifluoromethylbenzene?
The IUPAC name of chlorobenzene;trifluoromethylbenzene (CID 159341337) is chlorobenzene;trifluoromethylbenzene.
What is the SMILES notation for chlorobenzene;trifluoromethylbenzene?
The canonical SMILES for chlorobenzene;trifluoromethylbenzene is Clc1ccccc1.FC(F)(F)c1ccccc1.
What is the InChIKey of chlorobenzene;trifluoromethylbenzene?
The InChIKey is LGEGXTGRNMTIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.C6H5Cl/c8-7(9,10)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H;1-5H.
What are the key properties of chlorobenzene;trifluoromethylbenzene?
chlorobenzene;trifluoromethylbenzene has a molecular weight of 258.67 g/mol, XLogP of 5.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;trifluoromethylbenzene is sourced from PubChem (CID 159341337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).