About chlorobenzene;4-(trifluoromethyl)pyridazine
chlorobenzene;4-(trifluoromethyl)pyridazine (PubChem CID 158916977) has the molecular formula C11H8ClF3N2
and a molecular weight of 260.65 g/mol. Its IUPAC name is chlorobenzene;4-(trifluoromethyl)pyridazine.
Molecular Properties
| Compound Name | chlorobenzene;4-(trifluoromethyl)pyridazine |
| PubChem CID | 158916977 |
| Molecular Formula | C11H8ClF3N2 |
| Molecular Weight | 260.65 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | chlorobenzene;4-(trifluoromethyl)pyridazine |
| SMILES | Clc1ccccc1.FC(F)(F)c1ccnnc1 |
| InChI | InChI=1S/C6H5Cl.C5H3F3N2/c7-6-4-2-1-3-5-6;6-5(7,8)4-1-2-9-10-3-4/h1-5H;1-3H |
| InChIKey | JHIPVLKLDIPSHG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chlorobenzene;4-(trifluoromethyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;4-(trifluoromethyl)pyridazine?
The IUPAC name of chlorobenzene;4-(trifluoromethyl)pyridazine (CID 158916977) is chlorobenzene;4-(trifluoromethyl)pyridazine.
What is the SMILES notation for chlorobenzene;4-(trifluoromethyl)pyridazine?
The canonical SMILES for chlorobenzene;4-(trifluoromethyl)pyridazine is Clc1ccccc1.FC(F)(F)c1ccnnc1.
What is the InChIKey of chlorobenzene;4-(trifluoromethyl)pyridazine?
The InChIKey is JHIPVLKLDIPSHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl.C5H3F3N2/c7-6-4-2-1-3-5-6;6-5(7,8)4-1-2-9-10-3-4/h1-5H;1-3H.
What are the key properties of chlorobenzene;4-(trifluoromethyl)pyridazine?
chlorobenzene;4-(trifluoromethyl)pyridazine has a molecular weight of 260.65 g/mol, XLogP of 3.84, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;4-(trifluoromethyl)pyridazine is sourced from PubChem (CID 158916977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).