About (5Z)-4,6-diphenylhepta-1,5-dien-4-ol
(5Z)-4,6-diphenylhepta-1,5-dien-4-ol (PubChem CID 101172354) has the molecular formula C19H20O
and a molecular weight of 264.37 g/mol. Its IUPAC name is (5Z)-4,6-diphenylhepta-1,5-dien-4-ol.
Molecular Properties
| Compound Name | (5Z)-4,6-diphenylhepta-1,5-dien-4-ol |
| PubChem CID | 101172354 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (5Z)-4,6-diphenylhepta-1,5-dien-4-ol |
| SMILES | C=CCC(O)(/C=C(/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-3-14-19(20,18-12-8-5-9-13-18)15-16(2)17-10-6-4-7-11-17/h3-13,15,20H,1,14H2,2H3/b16-15- |
| InChIKey | YFHZTMDENNNDPY-NXVVXOECSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-4,6-diphenylhepta-1,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-4,6-diphenylhepta-1,5-dien-4-ol?
The IUPAC name of (5Z)-4,6-diphenylhepta-1,5-dien-4-ol (CID 101172354) is (5Z)-4,6-diphenylhepta-1,5-dien-4-ol.
What is the SMILES notation for (5Z)-4,6-diphenylhepta-1,5-dien-4-ol?
The canonical SMILES for (5Z)-4,6-diphenylhepta-1,5-dien-4-ol is C=CCC(O)(/C=C(/C)c1ccccc1)c1ccccc1.
What is the InChIKey of (5Z)-4,6-diphenylhepta-1,5-dien-4-ol?
The InChIKey is YFHZTMDENNNDPY-NXVVXOECSA-N. The full InChI is InChI=1S/C19H20O/c1-3-14-19(20,18-12-8-5-9-13-18)15-16(2)17-10-6-4-7-11-17/h3-13,15,20H,1,14H2,2H3/b16-15-.
What are the key properties of (5Z)-4,6-diphenylhepta-1,5-dien-4-ol?
(5Z)-4,6-diphenylhepta-1,5-dien-4-ol has a molecular weight of 264.37 g/mol, XLogP of 4.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-4,6-diphenylhepta-1,5-dien-4-ol is sourced from PubChem (CID 101172354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).