C19H20O — CID 101172354
(5Z)-4,6-diphenylhepta-1,5-dien-4-ol (PubChem CID 101172354) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (5Z)-4,6-diphenylhepta-1,5-dien-4-ol.
| Compound Name | (5Z)-4,6-diphenylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 101172354 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (5Z)-4,6-diphenylhepta-1,5-dien-4-ol |
| SMILES | C=CCC(O)(/C=C(/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H20O/c1-3-14-19(20,18-12-8-5-9-13-18)15-16(2)17-10-6-4-7-11-17/h3-13,15,20H,1,14H2,2H3/b16-15- |
| InChIKey | YFHZTMDENNNDPY-NXVVXOECSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|