C20H22O3 — CID 102105011
(1E)-1-(2,4-dimethoxyphenyl)-3-phenylhexa-1,5-dien-3-ol (PubChem CID 102105011) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1E)-1-(2,4-dimethoxyphenyl)-3-phenylhexa-1,5-dien-3-ol.
| Compound Name | (1E)-1-(2,4-dimethoxyphenyl)-3-phenylhexa-1,5-dien-3-ol |
|---|---|
| PubChem CID | 102105011 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (1E)-1-(2,4-dimethoxyphenyl)-3-phenylhexa-1,5-dien-3-ol |
| SMILES | C=CCC(O)(/C=C/c1ccc(OC)cc1OC)c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c1-4-13-20(21,17-8-6-5-7-9-17)14-12-16-10-11-18(22-2)15-19(16)23-3/h4-12,14-15,21H,1,13H2,2-3H3/b14-12+ |
| InChIKey | YVNMINMYOZBXIT-WYMLVPIESA-N |
| XLogP | 4.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|