C15H24O2 — CID 79449866
2-(2-methylpentyl)-2-phenylpropane-1,3-diol (PubChem CID 79449866) has the molecular formula C15H24O2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(2-methylpentyl)-2-phenylpropane-1,3-diol.
| Compound Name | 2-(2-methylpentyl)-2-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 79449866 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-(2-methylpentyl)-2-phenylpropane-1,3-diol |
| SMILES | CCCC(C)CC(CO)(CO)c1ccccc1 |
| InChI | InChI=1S/C15H24O2/c1-3-7-13(2)10-15(11-16,12-17)14-8-5-4-6-9-14/h4-6,8-9,13,16-17H,3,7,10-12H2,1-2H3 |
| InChIKey | JIQQHCRMSQTOEB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |