C15H23BrO2 — CID 79446991
2-(2-bromophenyl)-2-(2-methylpentyl)propane-1,3-diol (PubChem CID 79446991) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-(2-methylpentyl)propane-1,3-diol.
| Compound Name | 2-(2-bromophenyl)-2-(2-methylpentyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79446991 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(2-bromophenyl)-2-(2-methylpentyl)propane-1,3-diol |
| SMILES | CCCC(C)CC(CO)(CO)c1ccccc1Br |
| InChI | InChI=1S/C15H23BrO2/c1-3-6-12(2)9-15(10-17,11-18)13-7-4-5-8-14(13)16/h4-5,7-8,12,17-18H,3,6,9-11H2,1-2H3 |
| InChIKey | MHGLXSUDDHYLHP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |