C16H15BrCl2O2 — CID 107310880
2-(2-bromophenyl)-2-[(2,3-dichlorophenyl)methyl]propane-1,3-diol (PubChem CID 107310880) has the molecular formula C16H15BrCl2O2 and a molecular weight of 390.10 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-[(2,3-dichlorophenyl)methyl]propane-1,3-diol.
| Compound Name | 2-(2-bromophenyl)-2-[(2,3-dichlorophenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 107310880 |
| Molecular Formula | C16H15BrCl2O2 |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 2-(2-bromophenyl)-2-[(2,3-dichlorophenyl)methyl]propane-1,3-diol |
| SMILES | OCC(CO)(Cc1cccc(Cl)c1Cl)c1ccccc1Br |
| InChI | InChI=1S/C16H15BrCl2O2/c17-13-6-2-1-5-12(13)16(9-20,10-21)8-11-4-3-7-14(18)15(11)19/h1-7,20-21H,8-10H2 |
| InChIKey | ZAPIIZVFNQUCDP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |