C16H16Cl2O2 — CID 79447250
2-(2-chlorophenyl)-2-[(2-chlorophenyl)methyl]propane-1,3-diol (PubChem CID 79447250) has the molecular formula C16H16Cl2O2 and a molecular weight of 311.21 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[(2-chlorophenyl)methyl]propane-1,3-diol.
| Compound Name | 2-(2-chlorophenyl)-2-[(2-chlorophenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79447250 |
| Molecular Formula | C16H16Cl2O2 |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[(2-chlorophenyl)methyl]propane-1,3-diol |
| SMILES | OCC(CO)(Cc1ccccc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C16H16Cl2O2/c17-14-7-3-1-5-12(14)9-16(10-19,11-20)13-6-2-4-8-15(13)18/h1-8,19-20H,9-11H2 |
| InChIKey | JVIDEQDCOPKEGM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |