C19H32 — CID 57301668
(5-ethyl-2,7-dimethylnonan-5-yl)benzene (PubChem CID 57301668) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is (5-ethyl-2,7-dimethylnonan-5-yl)benzene.
| Compound Name | (5-ethyl-2,7-dimethylnonan-5-yl)benzene |
|---|---|
| PubChem CID | 57301668 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | (5-ethyl-2,7-dimethylnonan-5-yl)benzene |
| SMILES | CCC(C)CC(CC)(CCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32/c1-6-17(5)15-19(7-2,14-13-16(3)4)18-11-9-8-10-12-18/h8-12,16-17H,6-7,13-15H2,1-5H3 |
| InChIKey | NGQDMCKQQJVRLW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |