C14H19NO — CID 125465965
(2S,4S)-4-hydroxy-2-phenyl-2-propylpentanenitrile (PubChem CID 125465965) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-2-phenyl-2-propylpentanenitrile.
| Compound Name | (2S,4S)-4-hydroxy-2-phenyl-2-propylpentanenitrile |
|---|---|
| PubChem CID | 125465965 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (2S,4S)-4-hydroxy-2-phenyl-2-propylpentanenitrile |
| SMILES | CCC[C@](C#N)(C[C@H](C)O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-3-9-14(11-15,10-12(2)16)13-7-5-4-6-8-13/h4-8,12,16H,3,9-10H2,1-2H3/t12-,14+/m0/s1 |
| InChIKey | MJLZZJGTNXIZRI-GXTWGEPZSA-N |
| XLogP | 3.02 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |