C25H43N3 — CID 21320523
5-[di(propan-2-yl)amino]-2-[2-[di(propan-2-yl)amino]ethyl]-2-phenylpentanenitrile (PubChem CID 21320523) has the molecular formula C25H43N3 and a molecular weight of 385.64 g/mol. Its IUPAC name is 5-[di(propan-2-yl)amino]-2-[2-[di(propan-2-yl)amino]ethyl]-2-phenylpentanenitrile.
| Compound Name | 5-[di(propan-2-yl)amino]-2-[2-[di(propan-2-yl)amino]ethyl]-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 21320523 |
| Molecular Formula | C25H43N3 |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.35 |
| IUPAC Name | 5-[di(propan-2-yl)amino]-2-[2-[di(propan-2-yl)amino]ethyl]-2-phenylpentanenitrile |
| SMILES | CC(C)N(CCCC(C#N)(CCN(C(C)C)C(C)C)c1ccccc1)C(C)C |
| InChI | InChI=1S/C25H43N3/c1-20(2)27(21(3)4)17-12-15-25(19-26,24-13-10-9-11-14-24)16-18-28(22(5)6)23(7)8/h9-11,13-14,20-23H,12,15-18H2,1-8H3 |
| InChIKey | KLGYNNVADGGTAK-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |