C15H23N3 — CID 18789771
5-(2-aminoethylamino)-2-ethyl-2-phenylpentanenitrile (PubChem CID 18789771) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-(2-aminoethylamino)-2-ethyl-2-phenylpentanenitrile.
| Compound Name | 5-(2-aminoethylamino)-2-ethyl-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 18789771 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 5-(2-aminoethylamino)-2-ethyl-2-phenylpentanenitrile |
| SMILES | CCC(C#N)(CCCNCCN)c1ccccc1 |
| InChI | InChI=1S/C15H23N3/c1-2-15(13-17,9-6-11-18-12-10-16)14-7-4-3-5-8-14/h3-5,7-8,18H,2,6,9-12,16H2,1H3 |
| InChIKey | HMQWYJOSMCDSCO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|