About 3,5-dihydroxy-5,5-diphenylpentanenitrile
3,5-dihydroxy-5,5-diphenylpentanenitrile (PubChem CID 102249687) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3,5-dihydroxy-5,5-diphenylpentanenitrile.
Molecular Properties
| Compound Name | 3,5-dihydroxy-5,5-diphenylpentanenitrile |
| PubChem CID | 102249687 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3,5-dihydroxy-5,5-diphenylpentanenitrile |
| SMILES | N#CCC(O)CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c18-12-11-16(19)13-17(20,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,19-20H,11,13H2 |
| InChIKey | TVBBIDOXGRXPLT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dihydroxy-5,5-diphenylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dihydroxy-5,5-diphenylpentanenitrile?
The IUPAC name of 3,5-dihydroxy-5,5-diphenylpentanenitrile (CID 102249687) is 3,5-dihydroxy-5,5-diphenylpentanenitrile.
What is the SMILES notation for 3,5-dihydroxy-5,5-diphenylpentanenitrile?
The canonical SMILES for 3,5-dihydroxy-5,5-diphenylpentanenitrile is N#CCC(O)CC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3,5-dihydroxy-5,5-diphenylpentanenitrile?
The InChIKey is TVBBIDOXGRXPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2/c18-12-11-16(19)13-17(20,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,19-20H,11,13H2.
What are the key properties of 3,5-dihydroxy-5,5-diphenylpentanenitrile?
3,5-dihydroxy-5,5-diphenylpentanenitrile has a molecular weight of 267.33 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dihydroxy-5,5-diphenylpentanenitrile is sourced from PubChem (CID 102249687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).