About cyclohexane-1,1-diamine;dichloroplatinum
cyclohexane-1,1-diamine;dichloroplatinum (PubChem CID 21280166) has the molecular formula C6H14Cl2N2Pt
and a molecular weight of 380.18 g/mol. Its IUPAC name is cyclohexane-1,1-diamine;dichloroplatinum.
Molecular Properties
| Compound Name | cyclohexane-1,1-diamine;dichloroplatinum |
| PubChem CID | 21280166 |
| Molecular Formula | C6H14Cl2N2Pt |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | cyclohexane-1,1-diamine;dichloroplatinum |
| SMILES | Cl[Pt]Cl.NC1(N)CCCCC1 |
| InChI | InChI=1S/C6H14N2.2ClH.Pt/c7-6(8)4-2-1-3-5-6;;;/h1-5,7-8H2;2*1H;/q;;;+2/p-2 |
| InChIKey | XLWPIRNXCTZXMI-UHFFFAOYSA-L |
| XLogP | 1.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane-1,1-diamine;dichloroplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane-1,1-diamine;dichloroplatinum?
The IUPAC name of cyclohexane-1,1-diamine;dichloroplatinum (CID 21280166) is cyclohexane-1,1-diamine;dichloroplatinum.
What is the SMILES notation for cyclohexane-1,1-diamine;dichloroplatinum?
The canonical SMILES for cyclohexane-1,1-diamine;dichloroplatinum is Cl[Pt]Cl.NC1(N)CCCCC1.
What is the InChIKey of cyclohexane-1,1-diamine;dichloroplatinum?
The InChIKey is XLWPIRNXCTZXMI-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H14N2.2ClH.Pt/c7-6(8)4-2-1-3-5-6;;;/h1-5,7-8H2;2*1H;/q;;;+2/p-2.
What are the key properties of cyclohexane-1,1-diamine;dichloroplatinum?
cyclohexane-1,1-diamine;dichloroplatinum has a molecular weight of 380.18 g/mol, XLogP of 1.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane-1,1-diamine;dichloroplatinum is sourced from PubChem (CID 21280166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).