C6H12Cl2N2Pt+4 — CID 175690271
1-N',1-N'-dichlorocyclohexane-1,1-diamine;platinum(4+) (PubChem CID 175690271) has the molecular formula C6H12Cl2N2Pt+4 and a molecular weight of 378.16 g/mol. Its IUPAC name is 1-N',1-N'-dichlorocyclohexane-1,1-diamine;platinum(4+).
| Compound Name | 1-N',1-N'-dichlorocyclohexane-1,1-diamine;platinum(4+) |
|---|---|
| PubChem CID | 175690271 |
| Molecular Formula | C6H12Cl2N2Pt+4 |
| Molecular Weight | 378.16 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 1-N',1-N'-dichlorocyclohexane-1,1-diamine;platinum(4+) |
| SMILES | NC1(N(Cl)Cl)CCCCC1.[Pt+4] |
| InChI | InChI=1S/C6H12Cl2N2.Pt/c7-10(8)6(9)4-2-1-3-5-6;/h1-5,9H2;/q;+4 |
| InChIKey | ZDCFZHRDCAASAJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.16 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|