C13H18ClN — CID 84789567
1-(4-chloro-3,5-dimethylphenyl)cyclopentan-1-amine (PubChem CID 84789567) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylphenyl)cyclopentan-1-amine.
| Compound Name | 1-(4-chloro-3,5-dimethylphenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 84789567 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylphenyl)cyclopentan-1-amine |
| SMILES | Cc1cc(C2(N)CCCC2)cc(C)c1Cl |
| InChI | InChI=1S/C13H18ClN/c1-9-7-11(8-10(2)12(9)14)13(15)5-3-4-6-13/h7-8H,3-6,15H2,1-2H3 |
| InChIKey | GAEBOQZKPOIPKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |