C13H20N2 — CID 84778060
4-(1-aminocyclopentyl)-2,6-dimethylaniline (PubChem CID 84778060) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-(1-aminocyclopentyl)-2,6-dimethylaniline.
| Compound Name | 4-(1-aminocyclopentyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 84778060 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-(1-aminocyclopentyl)-2,6-dimethylaniline |
| SMILES | Cc1cc(C2(N)CCCC2)cc(C)c1N |
| InChI | InChI=1S/C13H20N2/c1-9-7-11(8-10(2)12(9)14)13(15)5-3-4-6-13/h7-8H,3-6,14-15H2,1-2H3 |
| InChIKey | VJBKDRWAHMAQRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|