About 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+)
1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) (PubChem CID 161294264) has the molecular formula C8H14N2O2Pt-2
and a molecular weight of 365.29 g/mol. Its IUPAC name is 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+).
Molecular Properties
| Compound Name | 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) |
| PubChem CID | 161294264 |
| Molecular Formula | C8H14N2O2Pt-2 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) |
| SMILES | [CH2-]C(=O)C1(C([CH2-])=O)CCC1.[NH2-].[NH2-].[Pt+2] |
| InChI | InChI=1S/C8H10O2.2H2N.Pt/c1-6(9)8(7(2)10)4-3-5-8;;;/h1-5H2;2*1H2;/q-2;2*-1;+2 |
| InChIKey | GOADMKPCTVBYIZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 101.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+)?
The IUPAC name of 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) (CID 161294264) is 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+).
What is the SMILES notation for 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+)?
The canonical SMILES for 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) is [CH2-]C(=O)C1(C([CH2-])=O)CCC1.[NH2-].[NH2-].[Pt+2].
What is the InChIKey of 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+)?
The InChIKey is GOADMKPCTVBYIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.2H2N.Pt/c1-6(9)8(7(2)10)4-3-5-8;;;/h1-5H2;2*1H2;/q-2;2*-1;+2.
What are the key properties of 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+)?
1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) has a molecular weight of 365.29 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-acetylcyclobutyl)ethanone;azanide;platinum(2+) is sourced from PubChem (CID 161294264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).