C12H20N2O4Pt — CID 24812607
(4-azanidylcyclohexyl)azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) (PubChem CID 24812607) has the molecular formula C12H20N2O4Pt and a molecular weight of 451.38 g/mol. Its IUPAC name is (4-azanidylcyclohexyl)azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+).
| Compound Name | (4-azanidylcyclohexyl)azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) |
|---|---|
| PubChem CID | 24812607 |
| Molecular Formula | C12H20N2O4Pt |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (4-azanidylcyclohexyl)azanide;cyclobutane-1,1-dicarboxylic acid;platinum(2+) |
| SMILES | O=C(O)C1(C(=O)O)CCC1.[NH-]C1CCC([NH-])CC1.[Pt+2] |
| InChI | InChI=1S/C6H12N2.C6H8O4.Pt/c7-5-1-2-6(8)4-3-5;7-4(8)6(5(9)10)2-1-3-6;/h5-8H,1-4H2;1-3H2,(H,7,8)(H,9,10);/q-2;;+2 |
| InChIKey | VSUXRAQMMMAXRJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|