C8H15AlO4 — CID 175587551
alumane;cyclohexane-1,1-dicarboxylic acid (PubChem CID 175587551) has the molecular formula C8H15AlO4 and a molecular weight of 202.19 g/mol. Its IUPAC name is alumane;cyclohexane-1,1-dicarboxylic acid.
| Compound Name | alumane;cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 175587551 |
| Molecular Formula | C8H15AlO4 |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | alumane;cyclohexane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCCCC1.[AlH3] |
| InChI | InChI=1S/C8H12O4.Al.3H/c9-6(10)8(7(11)12)4-2-1-3-5-8;;;;/h1-5H2,(H,9,10)(H,11,12);;;; |
| InChIKey | YHNNBUDEHZYINV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|