C16H24O6 — CID 175916236
cyclohexane-1,1-dicarbaldehyde;cyclohexane-1,1-dicarboxylic acid (PubChem CID 175916236) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is cyclohexane-1,1-dicarbaldehyde;cyclohexane-1,1-dicarboxylic acid.
| Compound Name | cyclohexane-1,1-dicarbaldehyde;cyclohexane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 175916236 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | cyclohexane-1,1-dicarbaldehyde;cyclohexane-1,1-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)CCCCC1.O=CC1(C=O)CCCCC1 |
| InChI | InChI=1S/C8H12O4.C8H12O2/c9-6(10)8(7(11)12)4-2-1-3-5-8;9-6-8(7-10)4-2-1-3-5-8/h1-5H2,(H,9,10)(H,11,12);6-7H,1-5H2 |
| InChIKey | HSFACFVDJVGQAH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|