C16H32O6 — CID 67028840
cyclohexane;cyclohexane-1,1-dicarboxylic acid;methanol (PubChem CID 67028840) has the molecular formula C16H32O6 and a molecular weight of 320.43 g/mol. Its IUPAC name is cyclohexane;cyclohexane-1,1-dicarboxylic acid;methanol.
| Compound Name | cyclohexane;cyclohexane-1,1-dicarboxylic acid;methanol |
|---|---|
| PubChem CID | 67028840 |
| Molecular Formula | C16H32O6 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | cyclohexane;cyclohexane-1,1-dicarboxylic acid;methanol |
| SMILES | C1CCCCC1.CO.CO.O=C(O)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C8H12O4.C6H12.2CH4O/c9-6(10)8(7(11)12)4-2-1-3-5-8;1-2-4-6-5-3-1;2*1-2/h1-5H2,(H,9,10)(H,11,12);1-6H2;2*2H,1H3 |
| InChIKey | GGDUBESKUGOMPJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|