C6H6CuO4 — CID 70616002
copper cyclobutane-1,1-dicarboxylate (PubChem CID 70616002) has the molecular formula C6H6CuO4 and a molecular weight of 205.66 g/mol. Its IUPAC name is copper cyclobutane-1,1-dicarboxylate.
| Compound Name | copper cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 70616002 |
| Molecular Formula | C6H6CuO4 |
| Molecular Weight | 205.66 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | copper cyclobutane-1,1-dicarboxylate |
| SMILES | O=C([O-])C1(C(=O)[O-])CCC1.[Cu+2] |
| InChI | InChI=1S/C6H8O4.Cu/c7-4(8)6(5(9)10)2-1-3-6;/h1-3H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| InChIKey | XNOMPRBJJHSLSO-UHFFFAOYSA-L |
| XLogP | -2.35 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.66 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|