C12H6O12-6 — CID 18515415
cyclohexane-1,1,2,2,3,3-hexacarboxylate (PubChem CID 18515415) has the molecular formula C12H6O12-6 and a molecular weight of 342.17 g/mol. Its IUPAC name is cyclohexane-1,1,2,2,3,3-hexacarboxylate.
| Compound Name | cyclohexane-1,1,2,2,3,3-hexacarboxylate |
|---|---|
| PubChem CID | 18515415 |
| Molecular Formula | C12H6O12-6 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | cyclohexane-1,1,2,2,3,3-hexacarboxylate |
| SMILES | O=C([O-])C1(C(=O)[O-])CCCC(C(=O)[O-])(C(=O)[O-])C1(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C12H12O12/c13-4(14)10(5(15)16)2-1-3-11(6(17)18,7(19)20)12(10,8(21)22)9(23)24/h1-3H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20)(H,21,22)(H,23,24)/p-6 |
| InChIKey | WLWKIJKUDWYINL-UHFFFAOYSA-H |
| XLogP | -9.37 |
| TPSA | 240.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | -9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|