C12H18O4-2 — CID 58183367
1,2-diethylcyclohexane-1,2-dicarboxylate (PubChem CID 58183367) has the molecular formula C12H18O4-2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1,2-diethylcyclohexane-1,2-dicarboxylate.
| Compound Name | 1,2-diethylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58183367 |
| Molecular Formula | C12H18O4-2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1,2-diethylcyclohexane-1,2-dicarboxylate |
| SMILES | CCC1(C(=O)[O-])CCCCC1(CC)C(=O)[O-] |
| InChI | InChI=1S/C12H20O4/c1-3-11(9(13)14)7-5-6-8-12(11,4-2)10(15)16/h3-8H2,1-2H3,(H,13,14)(H,15,16)/p-2 |
| InChIKey | HPWREGPUGZTZKG-UHFFFAOYSA-L |
| XLogP | -0.15 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |