C22H38O4S4-2 — CID 20502880
2,2-bis[3,4-bis(sulfanyl)heptyl]cyclohexane-1,1-dicarboxylate (PubChem CID 20502880) has the molecular formula C22H38O4S4-2 and a molecular weight of 494.81 g/mol. Its IUPAC name is 2,2-bis[3,4-bis(sulfanyl)heptyl]cyclohexane-1,1-dicarboxylate.
| Compound Name | 2,2-bis[3,4-bis(sulfanyl)heptyl]cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 20502880 |
| Molecular Formula | C22H38O4S4-2 |
| Molecular Weight | 494.81 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2,2-bis[3,4-bis(sulfanyl)heptyl]cyclohexane-1,1-dicarboxylate |
| SMILES | CCCC(S)C(S)CCC1(CCC(S)C(S)CCC)CCCCC1(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C22H40O4S4/c1-3-7-15(27)17(29)9-13-21(14-10-18(30)16(28)8-4-2)11-5-6-12-22(21,19(23)24)20(25)26/h15-18,27-30H,3-14H2,1-2H3,(H,23,24)(H,25,26)/p-2 |
| InChIKey | CLCDVEQLTSDHHU-UHFFFAOYSA-L |
| XLogP | 3.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|