About 1,2-diethylcyclobutane-1,2-dicarboxylate
1,2-diethylcyclobutane-1,2-dicarboxylate (PubChem CID 22298452) has the molecular formula C10H14O4-2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 1,2-diethylcyclobutane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1,2-diethylcyclobutane-1,2-dicarboxylate |
| PubChem CID | 22298452 |
| Molecular Formula | C10H14O4-2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1,2-diethylcyclobutane-1,2-dicarboxylate |
| SMILES | CCC1(C(=O)[O-])CCC1(CC)C(=O)[O-] |
| InChI | InChI=1S/C10H16O4/c1-3-9(7(11)12)5-6-10(9,4-2)8(13)14/h3-6H2,1-2H3,(H,11,12)(H,13,14)/p-2 |
| InChIKey | PGPLFBWBFUHPDP-UHFFFAOYSA-L |
| XLogP | -0.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,2-diethylcyclobutane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethylcyclobutane-1,2-dicarboxylate?
The IUPAC name of 1,2-diethylcyclobutane-1,2-dicarboxylate (CID 22298452) is 1,2-diethylcyclobutane-1,2-dicarboxylate.
What is the SMILES notation for 1,2-diethylcyclobutane-1,2-dicarboxylate?
The canonical SMILES for 1,2-diethylcyclobutane-1,2-dicarboxylate is CCC1(C(=O)[O-])CCC1(CC)C(=O)[O-].
What is the InChIKey of 1,2-diethylcyclobutane-1,2-dicarboxylate?
The InChIKey is PGPLFBWBFUHPDP-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H16O4/c1-3-9(7(11)12)5-6-10(9,4-2)8(13)14/h3-6H2,1-2H3,(H,11,12)(H,13,14)/p-2.
What are the key properties of 1,2-diethylcyclobutane-1,2-dicarboxylate?
1,2-diethylcyclobutane-1,2-dicarboxylate has a molecular weight of 198.22 g/mol, XLogP of -0.93, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethylcyclobutane-1,2-dicarboxylate is sourced from PubChem (CID 22298452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).