C8H10O5-2 — CID 53471492
(2R,3R)-2,3-diethyloxirane-2,3-dicarboxylate (PubChem CID 53471492) has the molecular formula C8H10O5-2 and a molecular weight of 186.16 g/mol. Its IUPAC name is (2R,3R)-2,3-diethyloxirane-2,3-dicarboxylate.
| Compound Name | (2R,3R)-2,3-diethyloxirane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 53471492 |
| Molecular Formula | C8H10O5-2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (2R,3R)-2,3-diethyloxirane-2,3-dicarboxylate |
| SMILES | CC[C@@]1(C(=O)[O-])O[C@@]1(CC)C(=O)[O-] |
| InChI | InChI=1S/C8H12O5/c1-3-7(5(9)10)8(4-2,13-7)6(11)12/h3-4H2,1-2H3,(H,9,10)(H,11,12)/p-2/t7-,8-/m0/s1 |
| InChIKey | NQGWAXMPSOVQDK-YUMQZZPRSA-L |
| XLogP | -2.19 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|