C18H29O7S4-3 — CID 20502886
3-[2,3-bis(sulfanyl)hexyl]-2-hydroxy-5,6-bis(sulfanyl)nonane-1,2,3-tricarboxylate (PubChem CID 20502886) has the molecular formula C18H29O7S4-3 and a molecular weight of 485.69 g/mol. Its IUPAC name is 3-[2,3-bis(sulfanyl)hexyl]-2-hydroxy-5,6-bis(sulfanyl)nonane-1,2,3-tricarboxylate.
| Compound Name | 3-[2,3-bis(sulfanyl)hexyl]-2-hydroxy-5,6-bis(sulfanyl)nonane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 20502886 |
| Molecular Formula | C18H29O7S4-3 |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 3-[2,3-bis(sulfanyl)hexyl]-2-hydroxy-5,6-bis(sulfanyl)nonane-1,2,3-tricarboxylate |
| SMILES | CCCC(S)C(S)CC(CC(S)C(S)CCC)(C(=O)[O-])C(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C18H32O7S4/c1-3-5-10(26)12(28)7-17(15(21)22,8-13(29)11(27)6-4-2)18(25,16(23)24)9-14(19)20/h10-13,25-29H,3-9H2,1-2H3,(H,19,20)(H,21,22)(H,23,24)/p-3 |
| InChIKey | FPFMBZQQBWFMBH-UHFFFAOYSA-K |
| XLogP | -1.08 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|