C4H4Na2O4S2 — CID 21153096
disodium;2,2-bis(sulfanyl)butanedioate (PubChem CID 21153096) has the molecular formula C4H4Na2O4S2 and a molecular weight of 226.19 g/mol. Its IUPAC name is disodium;2,2-bis(sulfanyl)butanedioate.
| Compound Name | disodium;2,2-bis(sulfanyl)butanedioate |
|---|---|
| PubChem CID | 21153096 |
| Molecular Formula | C4H4Na2O4S2 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 225.93 |
| IUPAC Name | disodium;2,2-bis(sulfanyl)butanedioate |
| SMILES | O=C([O-])CC(S)(S)C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H6O4S2.2Na/c5-2(6)1-4(9,10)3(7)8;;/h9-10H,1H2,(H,5,6)(H,7,8);;/q;2*+1/p-2 |
| InChIKey | MKCRFVKOJQYNAL-UHFFFAOYSA-L |
| XLogP | -8.56 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|