C9H11O7-3 — CID 22362002
2-hydroxy-4-methylpentane-1,2,3-tricarboxylate (PubChem CID 22362002) has the molecular formula C9H11O7-3 and a molecular weight of 231.18 g/mol. Its IUPAC name is 2-hydroxy-4-methylpentane-1,2,3-tricarboxylate.
| Compound Name | 2-hydroxy-4-methylpentane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 22362002 |
| Molecular Formula | C9H11O7-3 |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-hydroxy-4-methylpentane-1,2,3-tricarboxylate |
| SMILES | CC(C)C(C(=O)[O-])C(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H14O7/c1-4(2)6(7(12)13)9(16,8(14)15)3-5(10)11/h4,6,16H,3H2,1-2H3,(H,10,11)(H,12,13)(H,14,15)/p-3 |
| InChIKey | VSLFZLHDNAUFBN-UHFFFAOYSA-K |
| XLogP | -4.37 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |