C8H8O8-2 — CID 57373416
2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate (PubChem CID 57373416) has the molecular formula C8H8O8-2 and a molecular weight of 232.14 g/mol. Its IUPAC name is 2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate.
| Compound Name | 2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 57373416 |
| Molecular Formula | C8H8O8-2 |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate |
| SMILES | CC(=O)OC(=O)CC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H10O8/c1-4(9)16-6(12)3-8(15,7(13)14)2-5(10)11/h15H,2-3H2,1H3,(H,10,11)(H,13,14)/p-2 |
| InChIKey | WWXUGNUFCNYMFK-UHFFFAOYSA-L |
| XLogP | -3.91 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|