C7H6O9Sr — CID 174672555
strontium 2-(2-carboxyoxy-2-oxoethyl)-2-hydroxybutanedioate (PubChem CID 174672555) has the molecular formula C7H6O9Sr and a molecular weight of 321.74 g/mol. Its IUPAC name is strontium 2-(2-carboxyoxy-2-oxoethyl)-2-hydroxybutanedioate.
| Compound Name | strontium 2-(2-carboxyoxy-2-oxoethyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 174672555 |
| Molecular Formula | C7H6O9Sr |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.91 |
| IUPAC Name | strontium 2-(2-carboxyoxy-2-oxoethyl)-2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)(CC(=O)OC(=O)O)C(=O)[O-].[Sr+2] |
| InChI | InChI=1S/C7H8O9.Sr/c8-3(9)1-7(15,5(11)12)2-4(10)16-6(13)14;/h15H,1-2H2,(H,8,9)(H,11,12)(H,13,14);/q;+2/p-2 |
| InChIKey | IAMWZPQUMGQLCC-UHFFFAOYSA-L |
| XLogP | -4.16 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|