C8H8KNaO8 — CID 88764865
potassium;sodium;2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate (PubChem CID 88764865) has the molecular formula C8H8KNaO8 and a molecular weight of 294.23 g/mol. Its IUPAC name is potassium;sodium;2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate.
| Compound Name | potassium;sodium;2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 88764865 |
| Molecular Formula | C8H8KNaO8 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | potassium;sodium;2-(2-acetyloxy-2-oxoethyl)-2-hydroxybutanedioate |
| SMILES | CC(=O)OC(=O)CC(O)(CC(=O)[O-])C(=O)[O-].[K+].[Na+] |
| InChI | InChI=1S/C8H10O8.K.Na/c1-4(9)16-6(12)3-8(15,7(13)14)2-5(10)11;;/h15H,2-3H2,1H3,(H,10,11)(H,13,14);;/q;2*+1/p-2 |
| InChIKey | JPJCCRMHYZCNTQ-UHFFFAOYSA-L |
| XLogP | -9.90 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | -9.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|