C6H6CaO8 — CID 170914892
calcium 3-carboxy-2,3-dihydroxypentanedioate (PubChem CID 170914892) has the molecular formula C6H6CaO8 and a molecular weight of 246.18 g/mol. Its IUPAC name is calcium 3-carboxy-2,3-dihydroxypentanedioate.
| Compound Name | calcium 3-carboxy-2,3-dihydroxypentanedioate |
|---|---|
| PubChem CID | 170914892 |
| Molecular Formula | C6H6CaO8 |
| Molecular Weight | 246.18 g/mol |
| Exact Mass | 245.97 |
| IUPAC Name | calcium 3-carboxy-2,3-dihydroxypentanedioate |
| SMILES | O=C([O-])CC(O)(C(=O)O)C(O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C6H8O8.Ca/c7-2(8)1-6(14,5(12)13)3(9)4(10)11;/h3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13);/q;+2/p-2 |
| InChIKey | BFZQPSFCQNWCIY-UHFFFAOYSA-L |
| XLogP | -5.33 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.18 |
| LogP ≤ 5 | -5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |