C6H7GaO8 — CID 6711621
gallium;3-carboxy-3-hydroxypentanedioate;hydroxide (PubChem CID 6711621) has the molecular formula C6H7GaO8 and a molecular weight of 276.84 g/mol. Its IUPAC name is gallium;3-carboxy-3-hydroxypentanedioate;hydroxide.
| Compound Name | gallium;3-carboxy-3-hydroxypentanedioate;hydroxide |
|---|---|
| PubChem CID | 6711621 |
| Molecular Formula | C6H7GaO8 |
| Molecular Weight | 276.84 g/mol |
| Exact Mass | 275.94 |
| IUPAC Name | gallium;3-carboxy-3-hydroxypentanedioate;hydroxide |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.[Ga+3].[OH-] |
| InChI | InChI=1S/C6H8O7.Ga.H2O/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H2/q;+3;/p-3 |
| InChIKey | YRWRQUULVGSHPM-UHFFFAOYSA-K |
| XLogP | -4.48 |
| TPSA | 167.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.84 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |