C6H6AlClO7 — CID 88516210
aluminum;3-carboxy-3-hydroxypentanedioate;chloride (PubChem CID 88516210) has the molecular formula C6H6AlClO7 and a molecular weight of 252.54 g/mol. Its IUPAC name is aluminum;3-carboxy-3-hydroxypentanedioate;chloride.
| Compound Name | aluminum;3-carboxy-3-hydroxypentanedioate;chloride |
|---|---|
| PubChem CID | 88516210 |
| Molecular Formula | C6H6AlClO7 |
| Molecular Weight | 252.54 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | aluminum;3-carboxy-3-hydroxypentanedioate;chloride |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.[Al+3].[Cl-] |
| InChI | InChI=1S/C6H8O7.Al.ClH/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;1H/q;+3;/p-3 |
| InChIKey | VHHNTSRORUSONM-UHFFFAOYSA-K |
| XLogP | -7.29 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.54 |
| LogP ≤ 5 | -7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |