C6H6O8-2 — CID 4093067
2-[carboxy(hydroxy)methyl]-2-hydroxybutanedioate (PubChem CID 4093067) has the molecular formula C6H6O8-2 and a molecular weight of 206.11 g/mol. Its IUPAC name is 2-[carboxy(hydroxy)methyl]-2-hydroxybutanedioate.
| Compound Name | 2-[carboxy(hydroxy)methyl]-2-hydroxybutanedioate |
|---|---|
| PubChem CID | 4093067 |
| Molecular Formula | C6H6O8-2 |
| Molecular Weight | 206.11 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | 2-[carboxy(hydroxy)methyl]-2-hydroxybutanedioate |
| SMILES | O=C([O-])CC(O)(C(=O)[O-])C(O)C(=O)O |
| InChI | InChI=1S/C6H8O8/c7-2(8)1-6(14,5(12)13)3(9)4(10)11/h3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-2 |
| InChIKey | ZMJBYMUCKBYSCP-UHFFFAOYSA-L |
| XLogP | -4.95 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.11 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |