C9H12MgO10 — CID 87589072
magnesium;3-carboxy-3-hydroxypentanedioate;2-hydroxypropanoic acid (PubChem CID 87589072) has the molecular formula C9H12MgO10 and a molecular weight of 304.49 g/mol. Its IUPAC name is magnesium;3-carboxy-3-hydroxypentanedioate;2-hydroxypropanoic acid.
| Compound Name | magnesium;3-carboxy-3-hydroxypentanedioate;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 87589072 |
| Molecular Formula | C9H12MgO10 |
| Molecular Weight | 304.49 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | magnesium;3-carboxy-3-hydroxypentanedioate;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.O=C([O-])CC(O)(CC(=O)[O-])C(=O)O.[Mg+2] |
| InChI | InChI=1S/C6H8O7.C3H6O3.Mg/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2(4)3(5)6;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2,4H,1H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | RFDQPHUKLVENNT-UHFFFAOYSA-L |
| XLogP | -4.85 |
| TPSA | 195.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.49 |
| LogP ≤ 5 | -4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |