C7H7O7-3 — CID 3381253
3-(carboxylatomethyl)-3-hydroxypentanedioate (PubChem CID 3381253) has the molecular formula C7H7O7-3 and a molecular weight of 203.13 g/mol. Its IUPAC name is 3-(carboxylatomethyl)-3-hydroxypentanedioate.
| Compound Name | 3-(carboxylatomethyl)-3-hydroxypentanedioate |
|---|---|
| PubChem CID | 3381253 |
| Molecular Formula | C7H7O7-3 |
| Molecular Weight | 203.13 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | 3-(carboxylatomethyl)-3-hydroxypentanedioate |
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C7H10O7/c8-4(9)1-7(14,2-5(10)11)3-6(12)13/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-3 |
| InChIKey | CQOIYSASVHVTBU-UHFFFAOYSA-K |
| XLogP | -4.86 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.13 |
| LogP ≤ 5 | -4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |