C6H7O8Y2- — CID 58097663
3-carboxy-3,4,5-trihydroxy-5-oxopentanoate;bis(yttrium) (PubChem CID 58097663) has the molecular formula C6H7O8Y2- and a molecular weight of 384.93 g/mol. Its IUPAC name is 3-carboxy-3,4,5-trihydroxy-5-oxopentanoate;bis(yttrium).
| Compound Name | 3-carboxy-3,4,5-trihydroxy-5-oxopentanoate;bis(yttrium) |
|---|---|
| PubChem CID | 58097663 |
| Molecular Formula | C6H7O8Y2- |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.83 |
| IUPAC Name | 3-carboxy-3,4,5-trihydroxy-5-oxopentanoate;bis(yttrium) |
| SMILES | O=C([O-])CC(O)(C(=O)O)C(O)C(=O)O.[Y].[Y] |
| InChI | InChI=1S/C6H8O8.2Y/c7-2(8)1-6(14,5(12)13)3(9)4(10)11;;/h3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13);;/p-1 |
| InChIKey | YUNCVGSDRPELNN-UHFFFAOYSA-M |
| XLogP | -3.62 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |