3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid

C5H11NO3S — CID 137365491

IUPAC3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid
SMILESNC(CC(=O)O)SCCO
InChIInChI=1S/C5H11NO3S/c6-4(3-5(8)9)10-2-1-7/h4,7H,1-3,6H2,(H,8,9)
InChIKeyHOWRUAMIQALOPH-UHFFFAOYSA-N
MW165.21 g/mol
LogP-0.53
Rot. Bonds5

About 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid

3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid (PubChem CID 137365491) has the molecular formula C5H11NO3S and a molecular weight of 165.21 g/mol. Its IUPAC name is 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid.

Molecular Properties

Compound Name3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid
PubChem CID137365491
Molecular FormulaC5H11NO3S
Molecular Weight165.21 g/mol
Exact Mass165.05
IUPAC Name3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid
SMILESNC(CC(=O)O)SCCO
InChIInChI=1S/C5H11NO3S/c6-4(3-5(8)9)10-2-1-7/h4,7H,1-3,6H2,(H,8,9)
InChIKeyHOWRUAMIQALOPH-UHFFFAOYSA-N
XLogP-0.53
TPSA83.55 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.21
LogP ≤ 5-0.53
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid?
The IUPAC name of 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid (CID 137365491) is 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid.
What is the SMILES notation for 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid?
The canonical SMILES for 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid is NC(CC(=O)O)SCCO.
What is the InChIKey of 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid?
The InChIKey is HOWRUAMIQALOPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3S/c6-4(3-5(8)9)10-2-1-7/h4,7H,1-3,6H2,(H,8,9).
What are the key properties of 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid?
3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid has a molecular weight of 165.21 g/mol, XLogP of -0.53, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(2-hydroxyethylsulfanyl)propanoic acid is sourced from PubChem (CID 137365491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).