C19H32O10S4 — CID 58143061
[2-(3-sulfanylbutanoyloxymethyl)-3-(1-sulfanylethoxycarbonyloxy)-2-(1-sulfanylethoxycarbonyloxymethyl)propyl] 3-sulfanylbutanoate (PubChem CID 58143061) has the molecular formula C19H32O10S4 and a molecular weight of 548.72 g/mol. Its IUPAC name is [2-(3-sulfanylbutanoyloxymethyl)-3-(1-sulfanylethoxycarbonyloxy)-2-(1-sulfanylethoxycarbonyloxymethyl)propyl] 3-sulfanylbutanoate.
| Compound Name | [2-(3-sulfanylbutanoyloxymethyl)-3-(1-sulfanylethoxycarbonyloxy)-2-(1-sulfanylethoxycarbonyloxymethyl)propyl] 3-sulfanylbutanoate |
|---|---|
| PubChem CID | 58143061 |
| Molecular Formula | C19H32O10S4 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | [2-(3-sulfanylbutanoyloxymethyl)-3-(1-sulfanylethoxycarbonyloxy)-2-(1-sulfanylethoxycarbonyloxymethyl)propyl] 3-sulfanylbutanoate |
| SMILES | CC(S)CC(=O)OCC(COC(=O)CC(C)S)(COC(=O)OC(C)S)COC(=O)OC(C)S |
| InChI | InChI=1S/C19H32O10S4/c1-11(30)5-15(20)24-7-19(8-25-16(21)6-12(2)31,9-26-17(22)28-13(3)32)10-27-18(23)29-14(4)33/h11-14,30-33H,5-10H2,1-4H3 |
| InChIKey | JDUGYCIDYJVOGS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|